C12H19NO5 — CID 131862823
methyl 2-(5-methoxy-1,5-dioxopentan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 131862823) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 2-(5-methoxy-1,5-dioxopentan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-(5-methoxy-1,5-dioxopentan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131862823 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | methyl 2-(5-methoxy-1,5-dioxopentan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)CCC(C=O)C1CCCN1C(=O)OC |
| InChI | InChI=1S/C12H19NO5/c1-17-11(15)6-5-9(8-14)10-4-3-7-13(10)12(16)18-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | NJMQILNZGLZMEX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|