About (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one
(8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one (PubChem CID 131862953) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one.
Molecular Properties
| Compound Name | (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one |
| PubChem CID | 131862953 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one |
| SMILES | CC1=CC(=O)C2CC1C(C)=C/C2=N/O |
| InChI | InChI=1S/C11H13NO2/c1-6-3-10(12-14)9-5-8(6)7(2)4-11(9)13/h3-4,8-9,14H,5H2,1-2H3/b12-10- |
| InChIKey | FKYWTEULMHKYEQ-BENRWUELSA-N |
| XLogP | 1.93 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one?
The IUPAC name of (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one (CID 131862953) is (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one.
What is the SMILES notation for (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one?
The canonical SMILES for (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one is CC1=CC(=O)C2CC1C(C)=C/C2=N/O.
What is the InChIKey of (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one?
The InChIKey is FKYWTEULMHKYEQ-BENRWUELSA-N. The full InChI is InChI=1S/C11H13NO2/c1-6-3-10(12-14)9-5-8(6)7(2)4-11(9)13/h3-4,8-9,14H,5H2,1-2H3/b12-10-.
What are the key properties of (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one?
(8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one has a molecular weight of 191.23 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z)-8-hydroxyimino-4,6-dimethylbicyclo[3.3.1]nona-3,6-dien-2-one is sourced from PubChem (CID 131862953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).