C8H5Cl2NO4 — CID 131863205
methyl 3,5-dichloro-4-nitrobenzoate (PubChem CID 131863205) has the molecular formula C8H5Cl2NO4 and a molecular weight of 250.04 g/mol. Its IUPAC name is methyl 3,5-dichloro-4-nitrobenzoate.
| Compound Name | methyl 3,5-dichloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 131863205 |
| Molecular Formula | C8H5Cl2NO4 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | methyl 3,5-dichloro-4-nitrobenzoate |
| SMILES | COC(=O)c1cc(Cl)c([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2NO4/c1-15-8(12)4-2-5(9)7(11(13)14)6(10)3-4/h2-3H,1H3 |
| InChIKey | BVNCKSISWHEPAW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|