About benzo[f][1,2]benzoxazol-3-one
benzo[f][1,2]benzoxazol-3-one (PubChem CID 131863882) has the molecular formula C11H7NO2
and a molecular weight of 185.18 g/mol. Its IUPAC name is benzo[f][1,2]benzoxazol-3-one.
Molecular Properties
| Compound Name | benzo[f][1,2]benzoxazol-3-one |
| PubChem CID | 131863882 |
| Molecular Formula | C11H7NO2 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | benzo[f][1,2]benzoxazol-3-one |
| SMILES | O=c1[nH]oc2cc3ccccc3cc12 |
| InChI | InChI=1S/C11H7NO2/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)14-12-11/h1-6H,(H,12,13) |
| InChIKey | DPIGZCIBDUBRBC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[f][1,2]benzoxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f][1,2]benzoxazol-3-one?
The IUPAC name of benzo[f][1,2]benzoxazol-3-one (CID 131863882) is benzo[f][1,2]benzoxazol-3-one.
What is the SMILES notation for benzo[f][1,2]benzoxazol-3-one?
The canonical SMILES for benzo[f][1,2]benzoxazol-3-one is O=c1[nH]oc2cc3ccccc3cc12.
What is the InChIKey of benzo[f][1,2]benzoxazol-3-one?
The InChIKey is DPIGZCIBDUBRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO2/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)14-12-11/h1-6H,(H,12,13).
What are the key properties of benzo[f][1,2]benzoxazol-3-one?
benzo[f][1,2]benzoxazol-3-one has a molecular weight of 185.18 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f][1,2]benzoxazol-3-one is sourced from PubChem (CID 131863882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).