About CID 131865017
CID 131865017 (PubChem CID 131865017) has the molecular formula H2Cl2MgO6
and a molecular weight of 193.22 g/mol.
Molecular Properties
| Compound Name | CID 131865017 |
| PubChem CID | 131865017 |
| Molecular Formula | H2Cl2MgO6 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 191.91 |
| IUPAC Name | — |
| SMILES | [Mg].[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O |
| InChI | InChI=1S/2ClHO3.Mg/c2*2-1(3)4;/h2*2H; |
| InChIKey | YUVDTXZOAKQFCW-UHFFFAOYSA-N |
| XLogP | -6.25 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 131865017 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131865017?
The IUPAC name of CID 131865017 (CID 131865017) is not available.
What is the SMILES notation for CID 131865017?
The canonical SMILES for CID 131865017 is [Mg].[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.
What is the InChIKey of CID 131865017?
The InChIKey is YUVDTXZOAKQFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClHO3.Mg/c2*2-1(3)4;/h2*2H;.
What are the key properties of CID 131865017?
CID 131865017 has a molecular weight of 193.22 g/mol, XLogP of -6.25, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131865017 is sourced from PubChem (CID 131865017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).