About chloric acid;zinc
chloric acid;zinc (PubChem CID 131865070) has the molecular formula H2Cl2O6Zn
and a molecular weight of 234.31 g/mol. Its IUPAC name is chloric acid;zinc.
Molecular Properties
| Compound Name | chloric acid;zinc |
| PubChem CID | 131865070 |
| Molecular Formula | H2Cl2O6Zn |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 231.85 |
| IUPAC Name | chloric acid;zinc |
| SMILES | [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[Zn] |
| InChI | InChI=1S/2ClHO3.Zn/c2*2-1(3)4;/h2*2H; |
| InChIKey | NLSLIZAXCBDIIQ-UHFFFAOYSA-N |
| XLogP | -5.87 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloric acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloric acid;zinc?
The IUPAC name of chloric acid;zinc (CID 131865070) is chloric acid;zinc.
What is the SMILES notation for chloric acid;zinc?
The canonical SMILES for chloric acid;zinc is [O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[Zn].
What is the InChIKey of chloric acid;zinc?
The InChIKey is NLSLIZAXCBDIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClHO3.Zn/c2*2-1(3)4;/h2*2H;.
What are the key properties of chloric acid;zinc?
chloric acid;zinc has a molecular weight of 234.31 g/mol, XLogP of -5.87, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid;zinc is sourced from PubChem (CID 131865070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).