About 1-(furan-3-yl)pentane-1,4-diol
1-(furan-3-yl)pentane-1,4-diol (PubChem CID 13186539) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(furan-3-yl)pentane-1,4-diol.
Molecular Properties
| Compound Name | 1-(furan-3-yl)pentane-1,4-diol |
| PubChem CID | 13186539 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(furan-3-yl)pentane-1,4-diol |
| SMILES | CC(O)CCC(O)c1ccoc1 |
| InChI | InChI=1S/C9H14O3/c1-7(10)2-3-9(11)8-4-5-12-6-8/h4-7,9-11H,2-3H2,1H3 |
| InChIKey | AORCXYMSPVAQIZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(furan-3-yl)pentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)pentane-1,4-diol?
The IUPAC name of 1-(furan-3-yl)pentane-1,4-diol (CID 13186539) is 1-(furan-3-yl)pentane-1,4-diol.
What is the SMILES notation for 1-(furan-3-yl)pentane-1,4-diol?
The canonical SMILES for 1-(furan-3-yl)pentane-1,4-diol is CC(O)CCC(O)c1ccoc1.
What is the InChIKey of 1-(furan-3-yl)pentane-1,4-diol?
The InChIKey is AORCXYMSPVAQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(10)2-3-9(11)8-4-5-12-6-8/h4-7,9-11H,2-3H2,1H3.
What are the key properties of 1-(furan-3-yl)pentane-1,4-diol?
1-(furan-3-yl)pentane-1,4-diol has a molecular weight of 170.21 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)pentane-1,4-diol is sourced from PubChem (CID 13186539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).