About (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one
(1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one (PubChem CID 131865785) has the molecular formula C12H18Cl2O
and a molecular weight of 249.18 g/mol. Its IUPAC name is (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one.
Molecular Properties
| Compound Name | (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one |
| PubChem CID | 131865785 |
| Molecular Formula | C12H18Cl2O |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one |
| SMILES | O=C1[C@@H]2CCCCCCCC[C@@H]2C1(Cl)Cl |
| InChI | InChI=1S/C12H18Cl2O/c13-12(14)10-8-6-4-2-1-3-5-7-9(10)11(12)15/h9-10H,1-8H2/t9-,10+/m1/s1 |
| InChIKey | NMVKSDCMVOIADU-ZJUUUORDSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one?
The IUPAC name of (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one (CID 131865785) is (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one.
What is the SMILES notation for (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one?
The canonical SMILES for (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one is O=C1[C@@H]2CCCCCCCC[C@@H]2C1(Cl)Cl.
What is the InChIKey of (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one?
The InChIKey is NMVKSDCMVOIADU-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H18Cl2O/c13-12(14)10-8-6-4-2-1-3-5-7-9(10)11(12)15/h9-10H,1-8H2/t9-,10+/m1/s1.
What are the key properties of (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one?
(1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one has a molecular weight of 249.18 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,10R)-12,12-dichlorobicyclo[8.2.0]dodecan-11-one is sourced from PubChem (CID 131865785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).