[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid

C14H13BF2O2 — CID 131866445

IUPAC[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid
SMILESCCc1cccc(-c2ccc(B(O)O)c(F)c2F)c1
InChIInChI=1S/C14H13BF2O2/c1-2-9-4-3-5-10(8-9)11-6-7-12(15(18)19)14(17)13(11)16/h3-8,18-19H,2H2,1H3
InChIKeyXPSOELOMEDYHOF-UHFFFAOYSA-N
MW262.06 g/mol
LogP1.87
Rot. Bonds3

About [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid

[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid (PubChem CID 131866445) has the molecular formula C14H13BF2O2 and a molecular weight of 262.06 g/mol. Its IUPAC name is [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid.

Molecular Properties

Compound Name[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid
PubChem CID131866445
Molecular FormulaC14H13BF2O2
Molecular Weight262.06 g/mol
Exact Mass262.10
IUPAC Name[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid
SMILESCCc1cccc(-c2ccc(B(O)O)c(F)c2F)c1
InChIInChI=1S/C14H13BF2O2/c1-2-9-4-3-5-10(8-9)11-6-7-12(15(18)19)14(17)13(11)16/h3-8,18-19H,2H2,1H3
InChIKeyXPSOELOMEDYHOF-UHFFFAOYSA-N
XLogP1.87
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.06
LogP ≤ 51.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid?
The IUPAC name of [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid (CID 131866445) is [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid.
What is the SMILES notation for [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid?
The canonical SMILES for [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid is CCc1cccc(-c2ccc(B(O)O)c(F)c2F)c1.
What is the InChIKey of [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid?
The InChIKey is XPSOELOMEDYHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BF2O2/c1-2-9-4-3-5-10(8-9)11-6-7-12(15(18)19)14(17)13(11)16/h3-8,18-19H,2H2,1H3.
What are the key properties of [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid?
[4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid has a molecular weight of 262.06 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-ethylphenyl)-2,3-difluorophenyl]boronic acid is sourced from PubChem (CID 131866445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).