About N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine
N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine (PubChem CID 131866636) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine |
| PubChem CID | 131866636 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine |
| SMILES | NN1CCc2cc(C=NO)ccc21 |
| InChI | InChI=1S/C9H11N3O/c10-12-4-3-8-5-7(6-11-13)1-2-9(8)12/h1-2,5-6,13H,3-4,10H2 |
| InChIKey | OIXIBECNHOYZMM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine?
The IUPAC name of N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine (CID 131866636) is N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine?
The canonical SMILES for N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine is NN1CCc2cc(C=NO)ccc21.
What is the InChIKey of N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine?
The InChIKey is OIXIBECNHOYZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c10-12-4-3-8-5-7(6-11-13)1-2-9(8)12/h1-2,5-6,13H,3-4,10H2.
What are the key properties of N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine?
N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine has a molecular weight of 177.21 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-amino-2,3-dihydroindol-5-yl)methylidene]hydroxylamine is sourced from PubChem (CID 131866636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).