About [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol
[2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 131866725) has the molecular formula C12H12ClNO3S
and a molecular weight of 285.75 g/mol. Its IUPAC name is [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 131866725 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | COc1cc(OC)cc(-c2nc(Cl)sc2CO)c1 |
| InChI | InChI=1S/C12H12ClNO3S/c1-16-8-3-7(4-9(5-8)17-2)11-10(6-15)18-12(13)14-11/h3-5,15H,6H2,1-2H3 |
| InChIKey | NIRMIGLAAJUXDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol (CID 131866725) is [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol is COc1cc(OC)cc(-c2nc(Cl)sc2CO)c1.
What is the InChIKey of [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol?
The InChIKey is NIRMIGLAAJUXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO3S/c1-16-8-3-7(4-9(5-8)17-2)11-10(6-15)18-12(13)14-11/h3-5,15H,6H2,1-2H3.
What are the key properties of [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol?
[2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol has a molecular weight of 285.75 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 131866725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).