About 2,4-difluoroadamantane
2,4-difluoroadamantane (PubChem CID 13186696) has the molecular formula C10H14F2
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2,4-difluoroadamantane.
Molecular Properties
| Compound Name | 2,4-difluoroadamantane |
| PubChem CID | 13186696 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2,4-difluoroadamantane |
| SMILES | FC1C2CC3CC(C2)C(F)C1C3 |
| InChI | InChI=1S/C10H14F2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-10H,1-4H2 |
| InChIKey | IYFBIEZTKAKJDR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,4-difluoroadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoroadamantane?
The IUPAC name of 2,4-difluoroadamantane (CID 13186696) is 2,4-difluoroadamantane.
What is the SMILES notation for 2,4-difluoroadamantane?
The canonical SMILES for 2,4-difluoroadamantane is FC1C2CC3CC(C2)C(F)C1C3.
What is the InChIKey of 2,4-difluoroadamantane?
The InChIKey is IYFBIEZTKAKJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-10H,1-4H2.
What are the key properties of 2,4-difluoroadamantane?
2,4-difluoroadamantane has a molecular weight of 172.22 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoroadamantane is sourced from PubChem (CID 13186696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).