C17H14ClNO3 — CID 131867227
[3-(4-chlorophenyl)-5-(3-methoxyphenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131867227) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-5-(3-methoxyphenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-(4-chlorophenyl)-5-(3-methoxyphenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131867227 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [3-(4-chlorophenyl)-5-(3-methoxyphenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | COc1cccc(-c2onc(-c3ccc(Cl)cc3)c2CO)c1 |
| InChI | InChI=1S/C17H14ClNO3/c1-21-14-4-2-3-12(9-14)17-15(10-20)16(19-22-17)11-5-7-13(18)8-6-11/h2-9,20H,10H2,1H3 |
| InChIKey | LKHYZJGEZWJMPV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |