About 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole
4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole (PubChem CID 131867762) has the molecular formula C9H3Cl4NO
and a molecular weight of 282.94 g/mol. Its IUPAC name is 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole |
| PubChem CID | 131867762 |
| Molecular Formula | C9H3Cl4NO |
| Molecular Weight | 282.94 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole |
| SMILES | Clc1cccc(-c2noc(Cl)c2Cl)c1Cl |
| InChI | InChI=1S/C9H3Cl4NO/c10-5-3-1-2-4(6(5)11)8-7(12)9(13)15-14-8/h1-3H |
| InChIKey | OZTIOOFAZMILLO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole?
The IUPAC name of 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole (CID 131867762) is 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole.
What is the SMILES notation for 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole?
The canonical SMILES for 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole is Clc1cccc(-c2noc(Cl)c2Cl)c1Cl.
What is the InChIKey of 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole?
The InChIKey is OZTIOOFAZMILLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl4NO/c10-5-3-1-2-4(6(5)11)8-7(12)9(13)15-14-8/h1-3H.
What are the key properties of 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole?
4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole has a molecular weight of 282.94 g/mol, XLogP of 4.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3-(2,3-dichlorophenyl)-1,2-oxazole is sourced from PubChem (CID 131867762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).