About CID 131868800
CID 131868800 (PubChem CID 131868800) has the molecular formula C3H2N3
and a molecular weight of 80.07 g/mol.
Molecular Properties
| Compound Name | CID 131868800 |
| PubChem CID | 131868800 |
| Molecular Formula | C3H2N3 |
| Molecular Weight | 80.07 g/mol |
| Exact Mass | 80.02 |
| IUPAC Name | — |
| SMILES | N#C[C](N)C#N |
| InChI | InChI=1S/C3H2N3/c4-1-3(6)2-5/h6H2 |
| InChIKey | FCZOYLBFKAKCCR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.07 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 131868800 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131868800?
The IUPAC name of CID 131868800 (CID 131868800) is not available.
What is the SMILES notation for CID 131868800?
The canonical SMILES for CID 131868800 is N#C[C](N)C#N.
What is the InChIKey of CID 131868800?
The InChIKey is FCZOYLBFKAKCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N3/c4-1-3(6)2-5/h6H2.
What are the key properties of CID 131868800?
CID 131868800 has a molecular weight of 80.07 g/mol, XLogP of -0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131868800 is sourced from PubChem (CID 131868800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).