C10H7F3N2O2 — CID 131870999
1-[4-(trifluoromethyl)phenyl]pyrazolidine-3,5-dione (PubChem CID 131870999) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]pyrazolidine-3,5-dione.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 131870999 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]pyrazolidine-3,5-dione |
| SMILES | O=C1CC(=O)N(c2ccc(C(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)6-1-3-7(4-2-6)15-9(17)5-8(16)14-15/h1-4H,5H2,(H,14,16) |
| InChIKey | QZZLPFKXCIMPSE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|