About 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride
3-methyl-3-nitropentane-1,5-diamine;dihydrochloride (PubChem CID 131872100) has the molecular formula C6H17Cl2N3O2
and a molecular weight of 234.13 g/mol. Its IUPAC name is 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride |
| PubChem CID | 131872100 |
| Molecular Formula | C6H17Cl2N3O2 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride |
| SMILES | CC(CCN)(CCN)[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C6H15N3O2.2ClH/c1-6(2-4-7,3-5-8)9(10)11;;/h2-5,7-8H2,1H3;2*1H |
| InChIKey | QTUPWEVMWBNBOB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride?
The IUPAC name of 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride (CID 131872100) is 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride.
What is the SMILES notation for 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride?
The canonical SMILES for 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride is CC(CCN)(CCN)[N+](=O)[O-].Cl.Cl.
What is the InChIKey of 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride?
The InChIKey is QTUPWEVMWBNBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O2.2ClH/c1-6(2-4-7,3-5-8)9(10)11;;/h2-5,7-8H2,1H3;2*1H.
What are the key properties of 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride?
3-methyl-3-nitropentane-1,5-diamine;dihydrochloride has a molecular weight of 234.13 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-nitropentane-1,5-diamine;dihydrochloride is sourced from PubChem (CID 131872100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).