About 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride
1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride (PubChem CID 131872163) has the molecular formula C20H20Cl2N4
and a molecular weight of 387.31 g/mol. Its IUPAC name is 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride |
| PubChem CID | 131872163 |
| Molecular Formula | C20H20Cl2N4 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\c1ccccc1)c1ccc(/C(N)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N4.2ClH/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18;;/h1-14H,(H2,21,23)(H2,22,24);2*1H |
| InChIKey | QSWZHBGETDMUGJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride?
The IUPAC name of 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride (CID 131872163) is 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride.
What is the SMILES notation for 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride?
The canonical SMILES for 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride is Cl.Cl.N/C(=N\c1ccccc1)c1ccc(/C(N)=N/c2ccccc2)cc1.
What is the InChIKey of 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride?
The InChIKey is QSWZHBGETDMUGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4.2ClH/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18;;/h1-14H,(H2,21,23)(H2,22,24);2*1H.
What are the key properties of 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride?
1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride has a molecular weight of 387.31 g/mol, XLogP of 4.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride is sourced from PubChem (CID 131872163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).