C20H20Cl2N4 — CID 131872163
1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride (PubChem CID 131872163) has the molecular formula C20H20Cl2N4 and a molecular weight of 387.31 g/mol. Its IUPAC name is 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride.
| Compound Name | 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 131872163 |
| Molecular Formula | C20H20Cl2N4 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-N',4-N'-diphenylbenzene-1,4-dicarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\c1ccccc1)c1ccc(/C(N)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N4.2ClH/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18;;/h1-14H,(H2,21,23)(H2,22,24);2*1H |
| InChIKey | QSWZHBGETDMUGJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|