About 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one
4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one (PubChem CID 13187236) has the molecular formula C20H39N3O
and a molecular weight of 337.55 g/mol. Its IUPAC name is 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one.
Molecular Properties
| Compound Name | 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one |
| PubChem CID | 13187236 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one |
| SMILES | CCCCCCCCCCCCNCCN1CCN=C(C)CC1=O |
| InChI | InChI=1S/C20H39N3O/c1-3-4-5-6-7-8-9-10-11-12-13-21-14-16-23-17-15-22-19(2)18-20(23)24/h21H,3-18H2,1-2H3 |
| InChIKey | XGNTYYMJBAVALB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one?
The IUPAC name of 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one (CID 13187236) is 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one.
What is the SMILES notation for 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one?
The canonical SMILES for 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one is CCCCCCCCCCCCNCCN1CCN=C(C)CC1=O.
What is the InChIKey of 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one?
The InChIKey is XGNTYYMJBAVALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39N3O/c1-3-4-5-6-7-8-9-10-11-12-13-21-14-16-23-17-15-22-19(2)18-20(23)24/h21H,3-18H2,1-2H3.
What are the key properties of 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one?
4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one has a molecular weight of 337.55 g/mol, XLogP of 4.19, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one is sourced from PubChem (CID 13187236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).