C17H9F15N2O2 — CID 131872669
ethyl 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 131872669) has the molecular formula C17H9F15N2O2 and a molecular weight of 558.24 g/mol. Its IUPAC name is ethyl 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 131872669 |
| Molecular Formula | C17H9F15N2O2 |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | ethyl 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C17H9F15N2O2/c1-2-36-10(35)8-9(33-7-5-3-4-6-34(7)8)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h3-6H,2H2,1H3 |
| InChIKey | AILIUGSCIINIHV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|