C12H18O2 — CID 131873049
(4R,5S)-5-methyl-4-[(1E,3E)-5-methylhexa-1,3-dienyl]oxolan-2-one (PubChem CID 131873049) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (4R,5S)-5-methyl-4-[(1E,3E)-5-methylhexa-1,3-dienyl]oxolan-2-one.
| Compound Name | (4R,5S)-5-methyl-4-[(1E,3E)-5-methylhexa-1,3-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 131873049 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4R,5S)-5-methyl-4-[(1E,3E)-5-methylhexa-1,3-dienyl]oxolan-2-one |
| SMILES | CC(C)/C=C/C=C/[C@H]1CC(=O)O[C@H]1C |
| InChI | InChI=1S/C12H18O2/c1-9(2)6-4-5-7-11-8-12(13)14-10(11)3/h4-7,9-11H,8H2,1-3H3/b6-4+,7-5+/t10-,11-/m0/s1 |
| InChIKey | APOMINZZTATBJO-VLTQYQSMSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|