C16H18ClNO3 — CID 131873389
4-[(4R)-7-hydroxy-8-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl]benzene-1,2-diol;hydrochloride (PubChem CID 131873389) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 4-[(4R)-7-hydroxy-8-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl]benzene-1,2-diol;hydrochloride.
| Compound Name | 4-[(4R)-7-hydroxy-8-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 131873389 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[(4R)-7-hydroxy-8-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl]benzene-1,2-diol;hydrochloride |
| SMILES | Cc1c(O)ccc2c1CNC[C@@H]2c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C16H17NO3.ClH/c1-9-12-7-17-8-13(11(12)3-5-14(9)18)10-2-4-15(19)16(20)6-10;/h2-6,13,17-20H,7-8H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | KOHRHUOQWWENTM-BTQNPOSSSA-N |
| XLogP | 2.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|