C15H27ClN2O4 — CID 131873771
(1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;perchloric acid (PubChem CID 131873771) has the molecular formula C15H27ClN2O4 and a molecular weight of 334.84 g/mol. Its IUPAC name is (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;perchloric acid.
| Compound Name | (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;perchloric acid |
|---|---|
| PubChem CID | 131873771 |
| Molecular Formula | C15H27ClN2O4 |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;perchloric acid |
| SMILES | C1CCN2C[C@@H]3C[C@@H](CN4CCCC[C@@H]34)[C@H]2C1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C15H26N2.ClHO4/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;2-1(3,4)5/h12-15H,1-11H2;(H,2,3,4,5)/t12-,13-,14-,15+;/m0./s1 |
| InChIKey | UTIRDNDBRZZPRN-UMEYXWOPSA-N |
| XLogP | -1.78 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |