About (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal
(Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal (PubChem CID 13187390) has the molecular formula C5H4Cl4O
and a molecular weight of 221.90 g/mol. Its IUPAC name is (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal.
Molecular Properties
| Compound Name | (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal |
| PubChem CID | 13187390 |
| Molecular Formula | C5H4Cl4O |
| Molecular Weight | 221.90 g/mol |
| Exact Mass | 219.90 |
| IUPAC Name | (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal |
| SMILES | C/C(C=O)=C(/Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl4O/c1-3(2-10)4(6)5(7,8)9/h2H,1H3/b4-3- |
| InChIKey | DGIAAPGXINXXHF-ARJAWSKDSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal?
The IUPAC name of (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal (CID 13187390) is (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal.
What is the SMILES notation for (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal?
The canonical SMILES for (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal is C/C(C=O)=C(/Cl)C(Cl)(Cl)Cl.
What is the InChIKey of (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal?
The InChIKey is DGIAAPGXINXXHF-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H4Cl4O/c1-3(2-10)4(6)5(7,8)9/h2H,1H3/b4-3-.
What are the key properties of (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal?
(Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal has a molecular weight of 221.90 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4,4,4-tetrachloro-2-methylbut-2-enal is sourced from PubChem (CID 13187390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).