C11H14O4 — CID 131874289
[(3R,3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl] butanoate (PubChem CID 131874289) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is [(3R,3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl] butanoate.
| Compound Name | [(3R,3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl] butanoate |
|---|---|
| PubChem CID | 131874289 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [(3R,3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C(=O)O[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C11H14O4/c1-2-4-9(12)15-10-7-5-3-6-8(7)14-11(10)13/h3,6-8,10H,2,4-5H2,1H3/t7-,8+,10-/m1/s1 |
| InChIKey | YEZGPJNAYOZCEN-KHQFGBGNSA-N |
| XLogP | 1.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|