About 1,3-dimethyl-1,3-diazinane;dihydrochloride
1,3-dimethyl-1,3-diazinane;dihydrochloride (PubChem CID 131874566) has the molecular formula C6H16Cl2N2
and a molecular weight of 187.11 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diazinane;dihydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-1,3-diazinane;dihydrochloride |
| PubChem CID | 131874566 |
| Molecular Formula | C6H16Cl2N2 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1,3-dimethyl-1,3-diazinane;dihydrochloride |
| SMILES | CN1CCCN(C)C1.Cl.Cl |
| InChI | InChI=1S/C6H14N2.2ClH/c1-7-4-3-5-8(2)6-7;;/h3-6H2,1-2H3;2*1H |
| InChIKey | PZIUWQWAKZXYTL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-1,3-diazinane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,3-diazinane;dihydrochloride?
The IUPAC name of 1,3-dimethyl-1,3-diazinane;dihydrochloride (CID 131874566) is 1,3-dimethyl-1,3-diazinane;dihydrochloride.
What is the SMILES notation for 1,3-dimethyl-1,3-diazinane;dihydrochloride?
The canonical SMILES for 1,3-dimethyl-1,3-diazinane;dihydrochloride is CN1CCCN(C)C1.Cl.Cl.
What is the InChIKey of 1,3-dimethyl-1,3-diazinane;dihydrochloride?
The InChIKey is PZIUWQWAKZXYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.2ClH/c1-7-4-3-5-8(2)6-7;;/h3-6H2,1-2H3;2*1H.
What are the key properties of 1,3-dimethyl-1,3-diazinane;dihydrochloride?
1,3-dimethyl-1,3-diazinane;dihydrochloride has a molecular weight of 187.11 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,3-diazinane;dihydrochloride is sourced from PubChem (CID 131874566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).