C12H26O2Si — CID 131875010
[(Z)-5-methoxy-2,2-dimethylhex-3-en-3-yl]oxy-trimethylsilane (PubChem CID 131875010) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is [(Z)-5-methoxy-2,2-dimethylhex-3-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(Z)-5-methoxy-2,2-dimethylhex-3-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 131875010 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(Z)-5-methoxy-2,2-dimethylhex-3-en-3-yl]oxy-trimethylsilane |
| SMILES | COC(C)/C=C(\O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-10(13-5)9-11(12(2,3)4)14-15(6,7)8/h9-10H,1-8H3/b11-9- |
| InChIKey | SHUXASJEZZAZRS-LUAWRHEFSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|