C14H13NO3 — CID 131875296
methyl 7-methyl-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylate (PubChem CID 131875296) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 7-methyl-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylate.
| Compound Name | methyl 7-methyl-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 131875296 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 7-methyl-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylate |
| SMILES | COC(=O)C1Cn2c(cc3ccc(C)cc32)C1=O |
| InChI | InChI=1S/C14H13NO3/c1-8-3-4-9-6-12-13(16)10(14(17)18-2)7-15(12)11(9)5-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | NHDFKTZABVBWOZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|