C35H36ClNNaO3S — CID 131875440
CID 131875440 (PubChem CID 131875440) has the molecular formula C35H36ClNNaO3S and a molecular weight of 609.19 g/mol.
| Compound Name | CID 131875440 |
|---|---|
| PubChem CID | 131875440 |
| Molecular Formula | C35H36ClNNaO3S |
| Molecular Weight | 609.19 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | — |
| SMILES | CC(C)(O)c1ccccc1CC[C@H](SCC1(CC(=O)O)CC1)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1.[Na] |
| InChI | InChI=1S/C35H36ClNO3S.Na/c1-34(2,40)30-9-4-3-7-25(30)13-17-32(41-23-35(18-19-35)22-33(38)39)27-8-5-6-24(20-27)10-15-29-16-12-26-11-14-28(36)21-31(26)37-29;/h3-12,14-16,20-21,32,40H,13,17-19,22-23H2,1-2H3,(H,38,39);/b15-10+;/t32-;/m0./s1 |
| InChIKey | ZMFQNQCXWQXCFO-YBGTYPRZSA-N |
| XLogP | 8.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.19 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |