C28H34Cl2N6O2 — CID 131876055
1-N,3-N-bis[4-(N,N,N'-trimethylcarbamimidoyl)phenyl]benzene-1,3-dicarboxamide;dihydrochloride (PubChem CID 131876055) has the molecular formula C28H34Cl2N6O2 and a molecular weight of 557.53 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(N,N,N'-trimethylcarbamimidoyl)phenyl]benzene-1,3-dicarboxamide;dihydrochloride.
| Compound Name | 1-N,3-N-bis[4-(N,N,N'-trimethylcarbamimidoyl)phenyl]benzene-1,3-dicarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 131876055 |
| Molecular Formula | C28H34Cl2N6O2 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 1-N,3-N-bis[4-(N,N,N'-trimethylcarbamimidoyl)phenyl]benzene-1,3-dicarboxamide;dihydrochloride |
| SMILES | C/N=C(/c1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(/C(=N/C)N(C)C)cc3)c2)cc1)N(C)C.Cl.Cl |
| InChI | InChI=1S/C28H32N6O2.2ClH/c1-29-25(33(3)4)19-10-14-23(15-11-19)31-27(35)21-8-7-9-22(18-21)28(36)32-24-16-12-20(13-17-24)26(30-2)34(5)6;;/h7-18H,1-6H3,(H,31,35)(H,32,36);2*1H/b29-25-,30-26-;; |
| InChIKey | HEBHRMWQHAAMIS-STBURAHPSA-N |
| XLogP | 4.91 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|