C9H14N2O5 — CID 131876492
3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 131876492) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 131876492 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC([C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)=NN1 |
| InChI | InChI=1S/C9H14N2O5/c12-5-3-16-9(8(15)7(5)14)4-1-2-6(13)11-10-4/h5,7-9,12,14-15H,1-3H2,(H,11,13)/t5-,7+,8-,9+/m1/s1 |
| InChIKey | AGHNFFAHVYDVOR-JYFAAPFMSA-N |
| XLogP | -2.27 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |