About CID 131876705
CID 131876705 (PubChem CID 131876705) has the molecular formula C16H12N2NaO3
and a molecular weight of 303.27 g/mol.
Molecular Properties
| Compound Name | CID 131876705 |
| PubChem CID | 131876705 |
| Molecular Formula | C16H12N2NaO3 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | — |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccccc1C(=O)O.[Na] |
| InChI | InChI=1S/C16H12N2O3.Na/c1-10-17-13-8-4-2-6-11(13)15(19)18(10)14-9-5-3-7-12(14)16(20)21;/h2-9H,1H3,(H,20,21); |
| InChIKey | BHCYMDGQFQFRLT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 131876705 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131876705?
The IUPAC name of CID 131876705 (CID 131876705) is not available.
What is the SMILES notation for CID 131876705?
The canonical SMILES for CID 131876705 is Cc1nc2ccccc2c(=O)n1-c1ccccc1C(=O)O.[Na].
What is the InChIKey of CID 131876705?
The InChIKey is BHCYMDGQFQFRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O3.Na/c1-10-17-13-8-4-2-6-11(13)15(19)18(10)14-9-5-3-7-12(14)16(20)21;/h2-9H,1H3,(H,20,21);.
What are the key properties of CID 131876705?
CID 131876705 has a molecular weight of 303.27 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131876705 is sourced from PubChem (CID 131876705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).