About N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide
N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide (PubChem CID 131876741) has the molecular formula C21H27I2N3O2
and a molecular weight of 607.27 g/mol. Its IUPAC name is N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide.
Molecular Properties
| Compound Name | N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide |
| PubChem CID | 131876741 |
| Molecular Formula | C21H27I2N3O2 |
| Molecular Weight | 607.27 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide |
| SMILES | CCOc1cc(NCCCN)c2nc(OCc3ccccc3)ccc2c1.I.I |
| InChI | InChI=1S/C21H25N3O2.2HI/c1-2-25-18-13-17-9-10-20(26-15-16-7-4-3-5-8-16)24-21(17)19(14-18)23-12-6-11-22;;/h3-5,7-10,13-14,23H,2,6,11-12,15,22H2,1H3;2*1H |
| InChIKey | GXGCPXQXYLDBJH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide?
The IUPAC name of N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide (CID 131876741) is N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide.
What is the SMILES notation for N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide?
The canonical SMILES for N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide is CCOc1cc(NCCCN)c2nc(OCc3ccccc3)ccc2c1.I.I.
What is the InChIKey of N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide?
The InChIKey is GXGCPXQXYLDBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2.2HI/c1-2-25-18-13-17-9-10-20(26-15-16-7-4-3-5-8-16)24-21(17)19(14-18)23-12-6-11-22;;/h3-5,7-10,13-14,23H,2,6,11-12,15,22H2,1H3;2*1H.
What are the key properties of N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide?
N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide has a molecular weight of 607.27 g/mol, XLogP of 5.21, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;dihydroiodide is sourced from PubChem (CID 131876741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).