About CID 131877580
CID 131877580 (PubChem CID 131877580) has the molecular formula H6Cl2N2
and a molecular weight of 108.97 g/mol.
Molecular Properties
| Compound Name | CID 131877580 |
| PubChem CID | 131877580 |
| Molecular Formula | H6Cl2N2 |
| Molecular Weight | 108.97 g/mol |
| Exact Mass | 108.00 |
| IUPAC Name | — |
| SMILES | [15NH2][15NH2].[2H]Cl.[2H]Cl |
| InChI | InChI=1S/2ClH.H4N2/c;;1-2/h2*1H;1-2H2/i;;1+1,2+1/hD2 |
| InChIKey | LIAWOTKNAVAKCX-VTHUINLMSA-N |
| XLogP | -0.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.97 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 131877580 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131877580?
The IUPAC name of CID 131877580 (CID 131877580) is not available.
What is the SMILES notation for CID 131877580?
The canonical SMILES for CID 131877580 is [15NH2][15NH2].[2H]Cl.[2H]Cl.
What is the InChIKey of CID 131877580?
The InChIKey is LIAWOTKNAVAKCX-VTHUINLMSA-N. The full InChI is InChI=1S/2ClH.H4N2/c;;1-2/h2*1H;1-2H2/i;;1+1,2+1/hD2.
What are the key properties of CID 131877580?
CID 131877580 has a molecular weight of 108.97 g/mol, XLogP of -0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131877580 is sourced from PubChem (CID 131877580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).