About 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride
2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride (PubChem CID 131878906) has the molecular formula C15H19ClN2O
and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride |
| PubChem CID | 131878906 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride |
| SMILES | Cc1cc(C)nc(NCC(O)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C15H18N2O.ClH/c1-11-8-12(2)17-15(9-11)16-10-14(18)13-6-4-3-5-7-13;/h3-9,14,18H,10H2,1-2H3,(H,16,17);1H |
| InChIKey | GKYLKULRGLBFLM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride?
The IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride (CID 131878906) is 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride.
What is the SMILES notation for 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride?
The canonical SMILES for 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride is Cc1cc(C)nc(NCC(O)c2ccccc2)c1.Cl.
What is the InChIKey of 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride?
The InChIKey is GKYLKULRGLBFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.ClH/c1-11-8-12(2)17-15(9-11)16-10-14(18)13-6-4-3-5-7-13;/h3-9,14,18H,10H2,1-2H3,(H,16,17);1H.
What are the key properties of 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride?
2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride has a molecular weight of 278.78 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethyl-2-pyridinyl)amino]-1-phenylethanol;hydrochloride is sourced from PubChem (CID 131878906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).