About N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide
N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide (PubChem CID 131880390) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide |
| PubChem CID | 131880390 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2C=CC[C@@H](C2)C1 |
| InChI | InChI=1S/C11H17NO/c1-8(13)12-11-6-9-3-2-4-10(5-9)7-11/h2-3,9-11H,4-7H2,1H3,(H,12,13)/t9-,10+,11-/m1/s1 |
| InChIKey | NCAHZJGLRPWQGY-OUAUKWLOSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide?
The IUPAC name of N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide (CID 131880390) is N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide.
What is the SMILES notation for N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide?
The canonical SMILES for N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide is CC(=O)N[C@@H]1C[C@@H]2C=CC[C@@H](C2)C1.
What is the InChIKey of N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide?
The InChIKey is NCAHZJGLRPWQGY-OUAUKWLOSA-N. The full InChI is InChI=1S/C11H17NO/c1-8(13)12-11-6-9-3-2-4-10(5-9)7-11/h2-3,9-11H,4-7H2,1H3,(H,12,13)/t9-,10+,11-/m1/s1.
What are the key properties of N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide?
N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide has a molecular weight of 179.26 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3S,5R)-3-bicyclo[3.3.1]non-6-enyl]acetamide is sourced from PubChem (CID 131880390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).