C26H42N4O12S3 — CID 131880415
bis(N-[2-hydroxy-5-[hydroxy(piperidin-2-yl)methyl]phenyl]methanesulfonamide);sulfuric acid (PubChem CID 131880415) has the molecular formula C26H42N4O12S3 and a molecular weight of 698.84 g/mol. Its IUPAC name is bis(N-[2-hydroxy-5-[hydroxy(piperidin-2-yl)methyl]phenyl]methanesulfonamide);sulfuric acid.
| Compound Name | bis(N-[2-hydroxy-5-[hydroxy(piperidin-2-yl)methyl]phenyl]methanesulfonamide);sulfuric acid |
|---|---|
| PubChem CID | 131880415 |
| Molecular Formula | C26H42N4O12S3 |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | bis(N-[2-hydroxy-5-[hydroxy(piperidin-2-yl)methyl]phenyl]methanesulfonamide);sulfuric acid |
| SMILES | CS(=O)(=O)Nc1cc(C(O)C2CCCCN2)ccc1O.CS(=O)(=O)Nc1cc(C(O)C2CCCCN2)ccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/2C13H20N2O4S.H2O4S/c2*1-20(18,19)15-11-8-9(5-6-12(11)16)13(17)10-4-2-3-7-14-10;1-5(2,3)4/h2*5-6,8,10,13-17H,2-4,7H2,1H3;(H2,1,2,3,4) |
| InChIKey | BTZOPDIGNBRWJU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 271.92 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|