About 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride
5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride (PubChem CID 131880624) has the molecular formula C14H18Cl2N2O4S
and a molecular weight of 381.28 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride |
| PubChem CID | 131880624 |
| Molecular Formula | C14H18Cl2N2O4S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.NCCc1cc(O)c(O)c(S(=O)(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C14H16N2O4S.2ClH/c15-6-5-9-7-12(17)14(18)13(8-9)21(19,20)11-3-1-10(16)2-4-11;;/h1-4,7-8,17-18H,5-6,15-16H2;2*1H |
| InChIKey | RRTXTOLZWCBWDL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride?
The IUPAC name of 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride (CID 131880624) is 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride.
What is the SMILES notation for 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride?
The canonical SMILES for 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride is Cl.Cl.NCCc1cc(O)c(O)c(S(=O)(=O)c2ccc(N)cc2)c1.
What is the InChIKey of 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride?
The InChIKey is RRTXTOLZWCBWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4S.2ClH/c15-6-5-9-7-12(17)14(18)13(8-9)21(19,20)11-3-1-10(16)2-4-11;;/h1-4,7-8,17-18H,5-6,15-16H2;2*1H.
What are the key properties of 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride?
5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride has a molecular weight of 381.28 g/mol, XLogP of 1.86, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;dihydrochloride is sourced from PubChem (CID 131880624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).