About 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride
2-[4-(diethylamino)anilino]acetic acid;dihydrochloride (PubChem CID 131880910) has the molecular formula C12H20Cl2N2O2
and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride |
| PubChem CID | 131880910 |
| Molecular Formula | C12H20Cl2N2O2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride |
| SMILES | CCN(CC)c1ccc(NCC(=O)O)cc1.Cl.Cl |
| InChI | InChI=1S/C12H18N2O2.2ClH/c1-3-14(4-2)11-7-5-10(6-8-11)13-9-12(15)16;;/h5-8,13H,3-4,9H2,1-2H3,(H,15,16);2*1H |
| InChIKey | GYLRBGPYJUUMGU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride?
The IUPAC name of 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride (CID 131880910) is 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride.
What is the SMILES notation for 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride?
The canonical SMILES for 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride is CCN(CC)c1ccc(NCC(=O)O)cc1.Cl.Cl.
What is the InChIKey of 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride?
The InChIKey is GYLRBGPYJUUMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2.2ClH/c1-3-14(4-2)11-7-5-10(6-8-11)13-9-12(15)16;;/h5-8,13H,3-4,9H2,1-2H3,(H,15,16);2*1H.
What are the key properties of 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride?
2-[4-(diethylamino)anilino]acetic acid;dihydrochloride has a molecular weight of 295.21 g/mol, XLogP of 2.87, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(diethylamino)anilino]acetic acid;dihydrochloride is sourced from PubChem (CID 131880910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).