C15H18O4 — CID 131880991
(1R,2S,4S,6S,7R,8R,9S)-7-hydroxy-6-(hydroxymethyl)-12-propan-2-ylidene-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-en-3-one (PubChem CID 131880991) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (1R,2S,4S,6S,7R,8R,9S)-7-hydroxy-6-(hydroxymethyl)-12-propan-2-ylidene-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-en-3-one.
| Compound Name | (1R,2S,4S,6S,7R,8R,9S)-7-hydroxy-6-(hydroxymethyl)-12-propan-2-ylidene-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-en-3-one |
|---|---|
| PubChem CID | 131880991 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,2S,4S,6S,7R,8R,9S)-7-hydroxy-6-(hydroxymethyl)-12-propan-2-ylidene-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-en-3-one |
| SMILES | CC(C)=C1[C@H]2C=C[C@@H]1[C@@H]1C(=O)[C@H]3O[C@@]3(CO)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H18O4/c1-6(2)9-7-3-4-8(9)11-10(7)12(17)14-15(5-16,19-14)13(11)18/h3-4,7-8,10-11,13-14,16,18H,5H2,1-2H3/t7-,8+,10-,11+,13+,14+,15-/m0/s1 |
| InChIKey | SVEVPTBGMKHMHY-KRRHDXAPSA-N |
| XLogP | 0.44 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|