C14H14ClN — CID 131881423
9-chloro-4-methyl-1,2,3,4-tetrahydroacridine (PubChem CID 131881423) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is 9-chloro-4-methyl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-4-methyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 131881423 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 9-chloro-4-methyl-1,2,3,4-tetrahydroacridine |
| SMILES | CC1CCCc2c1nc1ccccc1c2Cl |
| InChI | InChI=1S/C14H14ClN/c1-9-5-4-7-11-13(15)10-6-2-3-8-12(10)16-14(9)11/h2-3,6,8-9H,4-5,7H2,1H3 |
| InChIKey | XBWIWKJNCCOGLZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |