About 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide
4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide (PubChem CID 131882361) has the molecular formula C6H18I2N6S2
and a molecular weight of 492.19 g/mol. Its IUPAC name is 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide.
Molecular Properties
| Compound Name | 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide |
| PubChem CID | 131882361 |
| Molecular Formula | C6H18I2N6S2 |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide |
| SMILES | I.I.N/N=C(\N)SCCCCS/C(N)=N/N |
| InChI | InChI=1S/C6H16N6S2.2HI/c7-5(11-9)13-3-1-2-4-14-6(8)12-10;;/h1-4,9-10H2,(H2,7,11)(H2,8,12);2*1H |
| InChIKey | SIOHFYLYUOIJBT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide?
The IUPAC name of 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide (CID 131882361) is 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide.
What is the SMILES notation for 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide?
The canonical SMILES for 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide is I.I.N/N=C(\N)SCCCCS/C(N)=N/N.
What is the InChIKey of 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide?
The InChIKey is SIOHFYLYUOIJBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N6S2.2HI/c7-5(11-9)13-3-1-2-4-14-6(8)12-10;;/h1-4,9-10H2,(H2,7,11)(H2,8,12);2*1H.
What are the key properties of 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide?
4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide has a molecular weight of 492.19 g/mol, XLogP of 0.85, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-C-aminocarbonohydrazonoyl]sulfanylbutyl N'-aminocarbamimidothioate;dihydroiodide is sourced from PubChem (CID 131882361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).