C18H11N5O3S — CID 13188238
2-(4-nitrophenyl)-7-[(E)-2-pyridin-3-ylethenyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 13188238) has the molecular formula C18H11N5O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-7-[(E)-2-pyridin-3-ylethenyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-(4-nitrophenyl)-7-[(E)-2-pyridin-3-ylethenyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 13188238 |
| Molecular Formula | C18H11N5O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-(4-nitrophenyl)-7-[(E)-2-pyridin-3-ylethenyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(/C=C/c2cccnc2)nc2sc(-c3ccc([N+](=O)[O-])cc3)nn12 |
| InChI | InChI=1S/C18H11N5O3S/c24-16-10-14(6-3-12-2-1-9-19-11-12)20-18-22(16)21-17(27-18)13-4-7-15(8-5-13)23(25)26/h1-11H/b6-3+ |
| InChIKey | VQPSZNLTFWICBF-ZZXKWVIFSA-N |
| XLogP | 3.29 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|