About dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane
dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane (PubChem CID 131882417) has the molecular formula C8H5Cl4F3Si
and a molecular weight of 328.02 g/mol. Its IUPAC name is dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane.
Molecular Properties
| Compound Name | dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane |
| PubChem CID | 131882417 |
| Molecular Formula | C8H5Cl4F3Si |
| Molecular Weight | 328.02 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane |
| SMILES | C[Si](Cl)(Cl)c1cc(Cl)c(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H5Cl4F3Si/c1-16(11,12)4-2-5(8(13,14)15)7(10)6(9)3-4/h2-3H,1H3 |
| InChIKey | QNXMHUADLJYANV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane?
The IUPAC name of dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane (CID 131882417) is dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane.
What is the SMILES notation for dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane?
The canonical SMILES for dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane is C[Si](Cl)(Cl)c1cc(Cl)c(Cl)c(C(F)(F)F)c1.
What is the InChIKey of dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane?
The InChIKey is QNXMHUADLJYANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl4F3Si/c1-16(11,12)4-2-5(8(13,14)15)7(10)6(9)3-4/h2-3H,1H3.
What are the key properties of dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane?
dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane has a molecular weight of 328.02 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[3,4-dichloro-5-(trifluoromethyl)phenyl]-methylsilane is sourced from PubChem (CID 131882417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).