C20H21Cl2N3O — CID 131882606
2-chloro-1-phenyl-N-piperidin-1-ylindole-3-carboxamide;hydrochloride (PubChem CID 131882606) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 2-chloro-1-phenyl-N-piperidin-1-ylindole-3-carboxamide;hydrochloride.
| Compound Name | 2-chloro-1-phenyl-N-piperidin-1-ylindole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 131882606 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-chloro-1-phenyl-N-piperidin-1-ylindole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NN1CCCCC1)c1c(Cl)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H20ClN3O.ClH/c21-19-18(20(25)22-23-13-7-2-8-14-23)16-11-5-6-12-17(16)24(19)15-9-3-1-4-10-15;/h1,3-6,9-12H,2,7-8,13-14H2,(H,22,25);1H |
| InChIKey | NOLKMZBTFBHUDO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |