C26H30N4O6 — CID 131882894
N-[6-amino-1-(2-methoxyphenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide (PubChem CID 131882894) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[6-amino-1-(2-methoxyphenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide.
| Compound Name | N-[6-amino-1-(2-methoxyphenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 131882894 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[6-amino-1-(2-methoxyphenyl)-3-methyl-2,4-dioxopyrimidin-5-yl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
| SMILES | COc1ccccc1-n1c(N)c(NC(=O)C2(C)CCc3c(C)c(O)c(C)c(C)c3O2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C26H30N4O6/c1-13-14(2)21-16(15(3)20(13)31)11-12-26(4,36-21)24(33)28-19-22(27)30(25(34)29(5)23(19)32)17-9-7-8-10-18(17)35-6/h7-10,31H,11-12,27H2,1-6H3,(H,28,33) |
| InChIKey | URNNPFWJMSESDQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |