C24H50Cl2N2 — CID 131883004
(4aR,8aR)-1,1,4,4-tetrabutyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-diium dichloride (PubChem CID 131883004) has the molecular formula C24H50Cl2N2 and a molecular weight of 437.58 g/mol. Its IUPAC name is (4aR,8aR)-1,1,4,4-tetrabutyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-diium dichloride.
| Compound Name | (4aR,8aR)-1,1,4,4-tetrabutyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-diium dichloride |
|---|---|
| PubChem CID | 131883004 |
| Molecular Formula | C24H50Cl2N2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (4aR,8aR)-1,1,4,4-tetrabutyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-diium dichloride |
| SMILES | CCCC[N+]1(CCCC)CC[N+](CCCC)(CCCC)[C@@H]2CCCC[C@H]21.[Cl-].[Cl-] |
| InChI | InChI=1S/C24H50N2.2ClH/c1-5-9-17-25(18-10-6-2)21-22-26(19-11-7-3,20-12-8-4)24-16-14-13-15-23(24)25;;/h23-24H,5-22H2,1-4H3;2*1H/q+2;;/p-2/t23-,24-;;/m1../s1 |
| InChIKey | XDZXOZMWRFCMLX-NILKIKDOSA-L |
| XLogP | 0.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|