C18H19F3N2O6 — CID 13188358
trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3S)-2,2-dimethyl-3-[(Z)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 13188358) has the molecular formula C18H19F3N2O6 and a molecular weight of 416.35 g/mol. Its IUPAC name is trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3S)-2,2-dimethyl-3-[(Z)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3S)-2,2-dimethyl-3-[(Z)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13188358 |
| Molecular Formula | C18H19F3N2O6 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3S)-2,2-dimethyl-3-[(Z)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C#CCN1CC(=O)N(COC(=O)[C@@H]2[C@H](/C=C\C(=O)OCC(F)(F)F)C2(C)C)C1=O |
| InChI | InChI=1S/C18H19F3N2O6/c1-4-7-22-8-12(24)23(16(22)27)10-29-15(26)14-11(17(14,2)3)5-6-13(25)28-9-18(19,20)21/h1,5-6,11,14H,7-10H2,2-3H3/b6-5-/t11-,14-/m0/s1 |
| InChIKey | QJCGYFNFFCEKJS-NCETYUCASA-N |
| XLogP | 1.32 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|