C16H10O6 — CID 131884068
8-hydroxy-3-methoxy-6-methylanthracene-1,2,9,10-tetrone (PubChem CID 131884068) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 8-hydroxy-3-methoxy-6-methylanthracene-1,2,9,10-tetrone.
| Compound Name | 8-hydroxy-3-methoxy-6-methylanthracene-1,2,9,10-tetrone |
|---|---|
| PubChem CID | 131884068 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 8-hydroxy-3-methoxy-6-methylanthracene-1,2,9,10-tetrone |
| SMILES | COc1cc2c(=O)c3cc(C)cc(O)c3c(=O)c=2c(=O)c1=O |
| InChI | InChI=1S/C16H10O6/c1-6-3-7-11(9(17)4-6)15(20)12-8(13(7)18)5-10(22-2)14(19)16(12)21/h3-5,17H,1-2H3 |
| InChIKey | SNWBTBXWBSUUGV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|