About Tyropanoate
Tyropanoate (PubChem CID 131884085) has the molecular formula C15H18I3NNaO3
and a molecular weight of 664.01 g/mol.
Molecular Properties
| Compound Name | Tyropanoate |
| PubChem CID | 131884085 |
| Molecular Formula | C15H18I3NNaO3 |
| Molecular Weight | 664.01 g/mol |
| Exact Mass | 663.83 |
| IUPAC Name | — |
| SMILES | CCCC(=O)Nc1c(I)cc(I)c(CC(CC)C(=O)O)c1I.[Na] |
| InChI | InChI=1S/C15H18I3NO3.Na/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22;/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22); |
| InChIKey | SOYYVBSRTOFMPV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 664.01 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze Tyropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tyropanoate?
The IUPAC name of Tyropanoate (CID 131884085) is not available.
What is the SMILES notation for Tyropanoate?
The canonical SMILES for Tyropanoate is CCCC(=O)Nc1c(I)cc(I)c(CC(CC)C(=O)O)c1I.[Na].
What is the InChIKey of Tyropanoate?
The InChIKey is SOYYVBSRTOFMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18I3NO3.Na/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22;/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22);.
What are the key properties of Tyropanoate?
Tyropanoate has a molecular weight of 664.01 g/mol, XLogP of 4.51, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tyropanoate is sourced from PubChem (CID 131884085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).